CAS 1171917-71-7

2-Bromo-4-(4-morpholinyl)phenol

Description:

2-Bromo-4-(4-morpholinyl)phenol is an organic compound characterized by its phenolic structure, which includes a bromine atom and a morpholine group. The presence of the bromine substituent at the second position and the morpholine moiety at the para position of the phenol ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the hydroxyl group, while the morpholine ring enhances its potential for hydrogen bonding and increases its lipophilicity. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic applications. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its stability and reactivity can be influenced by the electronic effects of the bromine and morpholine groups. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₂BrNO₂

InChI: InChI=1S/C10H12BrNO2/c11-9-7-8(1-2-10(9)13)12-3-5-14-6-4-12/h1-2,7,13H,3-6H2

InChI key: InChIKey=HKWSCPZDULJJDD-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1O)N2CCOCC2

Synonyms:

• 2-Bromo-4-(4-morpholinyl)phenol
• Phenol, 2-bromo-4-(4-morpholinyl)-