CymitQuimica logo

CAS 1171918-06-1

:

3,5-Difluoro-2-methoxypyridine

Description:
3,5-Difluoro-2-methoxypyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms at the 3 and 5 positions and a methoxy group at the 2 position. This compound typically exhibits a pale yellow to colorless appearance and is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its polar nature. The presence of fluorine atoms enhances its lipophilicity and can influence its reactivity and biological activity, making it of interest in medicinal chemistry and agrochemical applications. The methoxy group contributes to the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, 3,5-Difluoro-2-methoxypyridine may exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H5F2NO
InChI:InChI=1S/C6H5F2NO/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,1H3
InChI key:MEYHCABYUQUSKK-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=N1)F)F
Found 3 products.