CymitQuimica logo

CAS 1171918-79-8

:

N-Methoxy-N-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-3-piperidinecarboxamide

Description:
N-Methoxy-N-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-3-piperidinecarboxamide is a synthetic organic compound characterized by its complex molecular structure, which includes a piperidine ring, a methoxy group, and a nitro-substituted phenyl moiety. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of the methoxy and methyl groups contributes to its overall polarity and solubility properties. Typically, compounds of this nature are studied for their potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The nitro group can serve as a site for further chemical modifications, potentially leading to derivatives with varied biological activities. Additionally, the compound's molecular interactions, stability, and reactivity can be influenced by the electronic effects of the trifluoromethyl and nitro groups. Overall, this compound exemplifies the intricate design often found in pharmaceutical agents, where specific functional groups are strategically incorporated to achieve desired therapeutic effects.
Formula:C15H18F3N3O4
InChI:InChI=1S/C15H18F3N3O4/c1-19(25-2)14(22)10-4-3-7-20(9-10)13-6-5-11(21(23)24)8-12(13)15(16,17)18/h5-6,8,10H,3-4,7,9H2,1-2H3
InChI key:InChIKey=YLEOFNJZGIPYFE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC(N(=O)=O)=C1)N2CC(C(N(OC)C)=O)CCC2
Synonyms:
  • N-Methoxy-N-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-3-piperidinecarboxamide
  • 3-Piperidinecarboxamide, N-methoxy-N-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.