CAS 1171919-15-5

Ethyl 5-(2-quinolinyl)-2-thiophenecarboxylate

Description:

Ethyl 5-(2-quinolinyl)-2-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a quinoline moiety and a thiophene ring. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. The presence of the ethyl ester functional group suggests it may be relatively soluble in organic solvents, while the thiophene and quinoline rings can contribute to its electronic properties, making it of interest in various applications, including organic electronics and pharmaceuticals. Additionally, compounds with similar structures often display biological activity, which may include antimicrobial or anticancer properties. The specific reactivity and interactions of this compound can be influenced by its substituents and the overall electronic environment, making it a candidate for further research in synthetic chemistry and material science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₁₃NO₂S

InChI: InChI=1S/C16H13NO2S/c1-2-19-16(18)15-10-9-14(20-15)13-8-7-11-5-3-4-6-12(11)17-13/h3-10H,2H2,1H3

InChI key: InChIKey=PDGVKIURVOPASD-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(C2=NC3=C(C=C2)C=CC=C3)=CC1

Synonyms:

• Ethyl 5-(2-quinolinyl)-2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 5-(2-quinolinyl)-, ethyl ester