CAS 1171919-22-4
:2,4,6-Trichlorophenyl 8-quinolinesulfonate
Description:
2,4,6-Trichlorophenyl 8-quinolinesulfonate is a chemical compound characterized by its complex structure, which includes a trichlorophenyl group and a quinoline sulfonate moiety. This compound typically exhibits properties associated with both aromatic and sulfonate functionalities, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of chlorine atoms in the phenyl ring enhances its reactivity and may influence its biological activity. Additionally, the quinoline structure is known for its role in medicinal chemistry, often associated with antimalarial and antibacterial properties. The sulfonate group can enhance solubility in water, making the compound more bioavailable. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential, particularly in terms of persistence and bioaccumulation. Overall, 2,4,6-Trichlorophenyl 8-quinolinesulfonate represents a compound of interest for research and development, necessitating careful handling and assessment of its chemical behavior and potential applications.
Formula:C15H8Cl3NO3S
InChI:InChI=1S/C15H8Cl3NO3S/c16-10-7-11(17)15(12(18)8-10)22-23(20,21)13-5-1-3-9-4-2-6-19-14(9)13/h1-8H
InChI key:InChIKey=OHQJLFLDUIDPNE-UHFFFAOYSA-N
SMILES:S(OC1=C(Cl)C=C(Cl)C=C1Cl)(=O)(=O)C=2C3=C(C=CC2)C=CC=N3
Synonyms:- 8-Quinolinesulfonic acid, 2,4,6-trichlorophenyl ester
- 2,4,6-Trichlorophenyl 8-quinolinesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.