CAS 1171919-75-7

2-Chloro-4-iodonicotinonitrile

Description:

2-Chloro-4-iodonicotinonitrile is a chemical compound characterized by its unique structure, which includes a chlorinated and iodinated pyridine ring along with a nitrile functional group. This compound typically appears as a solid at room temperature and is known for its potential applications in medicinal chemistry and organic synthesis. The presence of both chlorine and iodine atoms in its structure can impart interesting reactivity and properties, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its nitrile group contributes to its polarity and can influence its solubility in different solvents. Additionally, the compound may exhibit biological activity, which can be explored in drug development. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose health risks. Overall, 2-Chloro-4-iodonicotinonitrile is a noteworthy compound in the field of organic chemistry, with potential implications in various research areas.

Formula: C₆H₂N₂ClI

InChI: InChI=1S/C6H2ClIN2/c7-6-4(3-9)5(8)1-2-10-6/h1-2H

SMILES: c1cnc(c(C#N)c1I)Cl

3-Pyridinecarbonitrile, 2-chloro-4-iodo-

CAS: 1171919-75-7

Formula: C₆H₂ClIN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.4510

Ref: IN-DA000DW1

2-Chloro-4-iodo-3-pyridinecarbonitrile

CAS: 1171919-75-7

2-Chloro-4-iodo-3-pyridinecarbonitrile

Purity: 97%

Molecular weight: 264.45g/mol

Ref: 54-OR72127

2-Chloro-4-iodonicotinonitrile

CAS: 1171919-75-7

Formula: C₆H₂ClIN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 264.45

Ref: 10-F442211