CAS 1171919-88-2

2,3-Dimethoxy-5-[2-(trimethylsilyl)ethynyl]pyridine

Description:

2,3-Dimethoxy-5-[2-(trimethylsilyl)ethynyl]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two methoxy groups at the 2 and 3 positions enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The ethynyl group, substituted with a trimethylsilyl moiety at the 5 position, provides unique properties such as increased stability and potential for further functionalization. This compound is likely to exhibit interesting electronic properties due to the conjugation between the aromatic system and the ethynyl group, making it a candidate for applications in organic synthesis, materials science, or medicinal chemistry. Its structural features suggest that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the trimethylsilyl group can serve as a protecting group for further synthetic transformations. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical applications.

Formula: C₁₂H₁₇NO₂Si

InChI: InChI=1S/C12H17NO2Si/c1-14-11-8-10(6-7-16(3,4)5)9-13-12(11)15-2/h8-9H,1-5H3

InChI key: InChIKey=KDNDGRWJNLKLHR-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)N=CC(C#C[Si](C)(C)C)=C1

Synonyms:

• 2,3-Dimethoxy-5-((trimethylsilyl)ethynyl)pyridine
• 2-(5,6-Dimethoxypyridin-3-yl)ethynyl-trimethylsilane
• Pyridine, 2,3-dimethoxy-5-[2-(trimethylsilyl)ethynyl]-
• 2,3-Dimethoxy-5-[2-(trimethylsilyl)ethynyl]pyridine