CAS 1171919-89-3
:3-(5,6-Dimethoxy-3-pyridinyl)-2-propyn-1-ol
Description:
3-(5,6-Dimethoxy-3-pyridinyl)-2-propyn-1-ol, identified by its CAS number 1171919-89-3, is an organic compound characterized by its unique structural features, including a pyridine ring substituted with two methoxy groups and a propynol functional group. The presence of the dimethoxy substituents enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can participate in hydrogen bonding. The pyridine moiety contributes to its aromatic properties, potentially affecting its reactivity and interaction with other chemical species. Additionally, the alkyne functionality (propynyl group) may provide sites for further chemical modifications or reactions, making it a versatile compound in synthetic organic chemistry. Its specific applications and biological activities would depend on further research, but compounds with similar structures are often explored for their potential in pharmaceuticals and agrochemicals.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-13-9-6-8(4-3-5-12)7-11-10(9)14-2/h6-7,12H,5H2,1-2H3
InChI key:InChIKey=HGJYEILCQKBSLF-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)N=CC(C#CCO)=C1
Synonyms:- 3-(5,6-Dimethoxy-3-pyridinyl)-2-propyn-1-ol
- 2-Propyn-1-ol, 3-(5,6-dimethoxy-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.