CymitQuimica logo

CAS 1171919-90-6

:

5-Bromo-N,3-dimethoxy-N-methyl-2-pyridinecarboxamide

Description:
5-Bromo-N,3-dimethoxy-N-methyl-2-pyridinecarboxamide is a chemical compound characterized by its unique structural features, which include a bromine atom, two methoxy groups, and a pyridine ring. The presence of the bromine substituent enhances its reactivity and potential applications in various chemical reactions. The dimethoxy groups contribute to the compound's polarity and solubility in organic solvents, making it suitable for various synthetic processes. As a pyridine derivative, it may exhibit biological activity, potentially interacting with biological targets due to the nitrogen atom in the ring, which can participate in hydrogen bonding. The amide functional group in the structure suggests that it may engage in hydrogen bonding, influencing its physical properties and reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and material science, where its unique properties can be harnessed for the development of new pharmaceuticals or functional materials. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C9H11BrN2O3
InChI:InChI=1S/C9H11BrN2O3/c1-12(15-3)9(13)8-7(14-2)4-6(10)5-11-8/h4-5H,1-3H3
InChI key:InChIKey=OTKONIFRHMHLGF-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=C(OC)C=C(Br)C=N1
Synonyms:
  • 5-Bromo-N,3-dimethoxy-N-methyl-2-pyridinecarboxamide
  • 2-Pyridinecarboxamide, 5-bromo-N,3-dimethoxy-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.