CAS 1171919-94-0

N-[2-Bromo-5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-3-pyridinyl]-2,2-dimethylpropanamide

Description:

N-[2-Bromo-5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring, a bromine substituent, and a dimethylsilyl ether group. The presence of the bromine atom suggests potential reactivity, particularly in nucleophilic substitution reactions. The dimethylsilyl group enhances the compound's stability and solubility in organic solvents, while the bulky tert-butyl group may influence its steric properties and reactivity. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic groups, which can affect its biological activity and interactions with other molecules. Additionally, the amide functional group contributes to its potential as a ligand in various chemical reactions. Overall, the unique combination of functional groups and structural features makes this compound of interest in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₁₇H₂₉BrN₂O₂Si

InChI: InChI=1S/C17H29BrN2O2Si/c1-16(2,3)15(21)20-13-9-12(10-19-14(13)18)11-22-23(7,8)17(4,5)6/h9-10H,11H2,1-8H3,(H,20,21)

InChI key: InChIKey=JWXIXHCQKKRIAJ-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C=1C=C(CO[Si](C(C)(C)C)(C)C)C=NC1Br

Synonyms:

• Propanamide, N-[2-bromo-5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-3-pyridinyl]-2,2-dimethyl-
• N-[2-Bromo-5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-3-pyridinyl]-2,2-dimethylpropanamide