CAS 1171919-96-2
:N-(2,3-Dimethoxy-4-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2,3-Dimethoxy-4-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with two methoxy groups at the 2 and 3 positions, and an amide functional group linked to a branched alkyl chain. This compound is typically classified as an organic amide and may exhibit properties such as moderate solubility in organic solvents, potential bioactivity, and specific interactions with biological targets due to its pyridine moiety. The presence of methoxy groups can influence its electronic properties and steric hindrance, potentially affecting its reactivity and pharmacological profile. As with many organic compounds, its stability, melting point, boiling point, and reactivity can vary based on environmental conditions and the presence of other substances. Safety data and handling precautions should be consulted, as with any chemical, to ensure proper usage and risk management in laboratory or industrial settings.
Formula:C12H18N2O3
InChI:InChI=1S/C12H18N2O3/c1-12(2,3)11(15)14-8-6-7-13-10(17-5)9(8)16-4/h6-7H,1-5H3,(H,13,14,15)
InChI key:InChIKey=OUTSFDFEIXJCRA-UHFFFAOYSA-N
SMILES:O(C)C=1C(NC(C(C)(C)C)=O)=CC=NC1OC
Synonyms:- Propanamide, N-(2,3-dimethoxy-4-pyridinyl)-2,2-dimethyl-
- N-(2,3-Dimethoxy-4-pyridinyl)-2,2-dimethylpropanamide
- N-(2,3-dimethoxypyridin-4-yl)-2,2-dimethylpropanamide
- N-(2,3-Dimethoxypyridin-4-yl)pivalamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.