CAS 1171919-99-5

N-(2-Formyl-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide

Description:

N-(2-Formyl-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a formyl group and a methoxy group, alongside a dimethylpropanamide moiety. This compound typically exhibits properties associated with both amides and aromatic heterocycles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the formyl group, which can participate in various chemical reactions, including condensation and nucleophilic addition. The methoxy group can influence the electronic properties of the pyridine ring, potentially affecting its reactivity and interaction with other molecules. Additionally, the presence of the dimethylpropanamide structure may contribute to steric hindrance, impacting the compound's overall reactivity and stability. Such compounds may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. However, specific biological activity and toxicity profiles would require further investigation through experimental studies.

Formula: C₁₂H₁₆N₂O₃

InChI: InChI=1S/C12H16N2O3/c1-12(2,3)11(16)14-8-5-6-13-9(7-15)10(8)17-4/h5-7H,1-4H3,(H,13,14,16)

InChI key: InChIKey=QADNQKKULUQQCJ-UHFFFAOYSA-N

SMILES: O(C)C=1C(NC(C(C)(C)C)=O)=CC=NC1C=O

Synonyms:

• Propanamide, N-(2-formyl-3-methoxy-4-pyridinyl)-2,2-dimethyl-
• N-(2-Formyl-3-methoxy-4-pyridinyl)-2,2-dimethylpropanamide