CymitQuimica logo

CAS 1171920-09-4

:

3-[2-(Trimethylsilyl)ethynyl]-4-pyridinol

Description:
3-[2-(Trimethylsilyl)ethynyl]-4-pyridinol, identified by its CAS number 1171920-09-4, is an organic compound featuring a pyridine ring substituted with an ethynyl group that is further modified by a trimethylsilyl group. This compound exhibits characteristics typical of both pyridine derivatives and alkynes, including potential aromaticity due to the pyridine structure, which contributes to its stability and reactivity. The presence of the trimethylsilyl group enhances its solubility in organic solvents and can influence its reactivity, making it useful in various synthetic applications. Additionally, the ethynyl group can participate in coupling reactions, making this compound valuable in organic synthesis and materials science. Its unique structure may also impart specific biological activities, although detailed biological data would require further investigation. Overall, 3-[2-(Trimethylsilyl)ethynyl]-4-pyridinol is a versatile compound with applications in organic chemistry and potentially in medicinal chemistry, depending on its reactivity and functionalization potential.
Formula:C10H13NOSi
InChI:InChI=1S/C10H13NOSi/c1-13(2,3)7-5-9-8-11-6-4-10(9)12/h4,6,8H,1-3H3,(H,11,12)
InChI key:InChIKey=LXXUYRLPYDXQKD-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C=1C(O)=CC=NC1
Synonyms:
  • 3-[2-(Trimethylsilyl)ethynyl]-4-pyridinol
  • 4-Pyridinol, 3-[2-(trimethylsilyl)ethynyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.