CymitQuimica logo

CAS 1171920-13-0

:

2-Chloro-3-(dimethoxymethyl)-4-[2-(trimethylsilyl)ethynyl]pyridine

Description:
2-Chloro-3-(dimethoxymethyl)-4-[2-(trimethylsilyl)ethynyl]pyridine is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a chloro group indicates potential reactivity, particularly in nucleophilic substitution reactions. The dimethoxymethyl group suggests that the compound may exhibit solubility in polar solvents, while the trimethylsilyl ethynyl moiety can enhance stability and influence the compound's electronic properties. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features, which could impart specific biological activities or facilitate interactions in polymer chemistry. Its synthesis typically involves multi-step reactions, highlighting the importance of careful handling and characterization techniques such as NMR and mass spectrometry to confirm its identity and purity. As with many organosilicon compounds, it may also exhibit interesting properties related to its silicon content, such as hydrophobicity or altered volatility. Overall, this compound represents a versatile building block for further chemical exploration and application.
Formula:C13H18ClNO2Si
InChI:InChI=1S/C13H18ClNO2Si/c1-16-13(17-2)11-10(6-8-15-12(11)14)7-9-18(3,4)5/h6,8,13H,1-5H3
InChI key:InChIKey=DLVPXJJDUWQWIT-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C(C#C[Si](C)(C)C)=CC=NC1Cl
Synonyms:
  • 2-Chloro-3-(dimethoxymethyl)-4-[2-(trimethylsilyl)ethynyl]pyridine
  • Pyridine, 2-chloro-3-(dimethoxymethyl)-4-[2-(trimethylsilyl)ethynyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.