CAS 1171920-30-1

2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-6-iodofuro[3,2-b]pyridine

Description:

2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-6-iodofuro[3,2-b]pyridine is a complex organic compound characterized by its unique structural features, including a furo[3,2-b]pyridine core, which is a bicyclic structure that incorporates both furan and pyridine functionalities. The presence of a dimethylsilyl group enhances its stability and solubility, while the tert-butyl group contributes to steric hindrance, influencing its reactivity and interactions. The iodine substituent at the 6-position of the furo-pyridine ring can impart specific reactivity, making it a potential candidate for various chemical transformations. This compound may exhibit interesting biological activities due to its structural complexity, and its siloxy and iodide functionalities could play roles in mediating interactions with biological targets. Overall, the combination of these features suggests that this compound could be of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₄H₂₀INO₂Si

InChI: InChI=1S/C14H20INO2Si/c1-14(2,3)19(4,5)17-9-11-7-12-13(18-11)6-10(15)8-16-12/h6-8H,9H2,1-5H3

InChI key: InChIKey=JTVGUIFTDJPUDJ-UHFFFAOYSA-N

SMILES: C(O[Si](C(C)(C)C)(C)C)C1=CC=2C(O1)=CC(I)=CN2

Synonyms:

• 2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-6-iodofuro[3,2-b]pyridine
• Furo[3,2-b]pyridine, 2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-6-iodo-