CAS 1171920-37-8
:N-[2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridin-7-yl]-2,2-dimethylpropanamide
Description:
N-[2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridin-7-yl]-2,2-dimethylpropanamide, identified by its CAS number 1171920-37-8, is a synthetic organic compound characterized by its complex structure that includes a furo[3,2-b]pyridine moiety and a dimethylsilyl group. This compound features a dimethylpropanamide functional group, which contributes to its potential as a bioactive molecule. The presence of the dimethylethyl group suggests hydrophobic characteristics, which may influence its solubility and interaction with biological systems. The silyl ether functionality can enhance stability and protect against hydrolysis, making it useful in various chemical applications. Its unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, the compound's characteristics, including its molecular stability, hydrophobicity, and potential biological activity, make it a subject of interest for further research in drug development and chemical synthesis.
Formula:C19H30N2O3Si
InChI:InChI=1S/C19H30N2O3Si/c1-18(2,3)17(22)21-14-9-10-20-15-11-13(24-16(14)15)12-23-25(7,8)19(4,5)6/h9-11H,12H2,1-8H3,(H,20,21,22)
InChI key:InChIKey=LZUUGADYQQZQNM-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=C2C(C=C(CO[Si](C(C)(C)C)(C)C)O2)=NC=C1
Synonyms:- N-[2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridin-7-yl]-2,2-dimethylpropanamide
- Propanamide, N-[2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridin-7-yl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2-((tert-Butyldimethylsilyloxy)methyl)furo[3,2-b]pyridin-7-yl)pivalamide
CAS:Controlled ProductFormula:C19H30N2O3SiColor and Shape:NeatMolecular weight:362.539
