CAS 1171920-41-4
:2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-6-(trimethylsilyl)furo[3,2-b]pyridine
Description:
2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-6-(trimethylsilyl)furo[3,2-b]pyridine is a complex organic compound characterized by its unique structural features, which include a furo[3,2-b]pyridine core, multiple silyl groups, and a tert-butyl substituent. The presence of silyl groups enhances its stability and solubility in organic solvents, making it useful in various chemical applications, including as a potential intermediate in organic synthesis. The furo[3,2-b]pyridine structure contributes to its aromatic properties, which can influence its reactivity and interaction with other chemical species. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological potential. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, depending on the reaction conditions. Overall, this compound represents a fascinating example of organosilicon chemistry with potential applications in materials science and medicinal chemistry.
Formula:C17H29NO2Si2
InChI:InChI=1S/C17H29NO2Si2/c1-17(2,3)22(7,8)19-12-13-9-15-16(20-13)10-14(11-18-15)21(4,5)6/h9-11H,12H2,1-8H3
InChI key:InChIKey=IVHXBVMEXOGGSN-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C=1C=C2C(C=C(CO[Si](C(C)(C)C)(C)C)O2)=NC1
Synonyms:- 2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-6-(trimethylsilyl)furo[3,2-b]pyridine
- Furo[3,2-b]pyridine, 2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-6-(trimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.