CAS 1171920-49-2

2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridine-6-carboxylic acid

Description:

2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridine-6-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a furo[3,2-b]pyridine core, a carboxylic acid functional group, and a silyl ether moiety. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents, while the carboxylic acid group contributes to its acidity and potential reactivity in various chemical reactions. This compound may exhibit interesting biological activities due to its structural motifs, making it a candidate for pharmaceutical applications. Its synthesis typically involves multi-step organic reactions, and it may be utilized in research settings for studying its properties and potential uses. The compound's CAS number, 1171920-49-2, serves as a unique identifier in chemical databases, facilitating its identification and retrieval of related information. Overall, this substance represents a blend of organic chemistry and potential applications in medicinal chemistry.

Formula: C₁₅H₂₁NO₄Si

InChI: InChI=1S/C15H21NO4Si/c1-15(2,3)21(4,5)19-9-11-7-12-13(20-11)6-10(8-16-12)14(17)18/h6-8H,9H2,1-5H3,(H,17,18)

InChI key: InChIKey=LPAAHOPBWVHPDY-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(C=C(CO[Si](C(C)(C)C)(C)C)O2)=NC1

Synonyms:

• 2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]furo[3,2-b]pyridine-6-carboxylic acid
• Furo[3,2-b]pyridine-6-carboxylic acid, 2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-