CAS 1171920-66-3

3-Methyl-6-(trimethylsilyl)-3H-imidazo[4,5-b]pyridine

Description:

3-Methyl-6-(trimethylsilyl)-3H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine core structure, which features a fused ring system containing nitrogen atoms. The presence of a methyl group at the 3-position and a trimethylsilyl group at the 6-position contributes to its unique chemical properties, including increased lipophilicity and potential for enhanced stability. This compound is typically used in organic synthesis and medicinal chemistry, often serving as a building block for more complex molecules. Its trimethylsilyl group can act as a protecting group for functional groups during chemical reactions, facilitating various transformations. The compound's reactivity may be influenced by the electron-donating and electron-withdrawing effects of the substituents, making it a subject of interest in the development of pharmaceuticals and agrochemicals. Additionally, its structural features may impart specific biological activities, warranting further investigation in drug discovery and development contexts.

Formula: C₁₀H₁₅N₃Si

InChI: InChI=1S/C10H15N3Si/c1-13-7-12-9-5-8(14(2,3)4)6-11-10(9)13/h5-7H,1-4H3

InChI key: InChIKey=WDQCEVJQYHRSSP-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC([Si](C)(C)C)=CN2)N=C1

Synonyms:

• 3-Methyl-6-(trimethylsilyl)-3H-imidazo[4,5-b]pyridine
• 3H-Imidazo[4,5-b]pyridine, 3-methyl-6-(trimethylsilyl)-