CymitQuimica logo

CAS 1171920-73-2

:

3-(3-Methyl-3H-imidazo[4,5-b]pyridin-6-yl)-2-propyn-1-ol

Description:
3-(3-Methyl-3H-imidazo[4,5-b]pyridin-6-yl)-2-propyn-1-ol, with the CAS number 1171920-73-2, is a chemical compound characterized by its unique structural features, which include an imidazo[4,5-b]pyridine moiety and a propynol functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen atoms in the ring structure. The hydroxyl group (-OH) in the propynol part of the molecule may contribute to its reactivity and solubility in polar solvents. Additionally, the presence of the propynyl group suggests that it may participate in various chemical reactions, including nucleophilic substitutions or coupling reactions. The compound's specific applications and biological activities would depend on its interactions with biological targets, making it of interest in medicinal chemistry and drug development. Overall, its structural complexity and functional groups suggest potential utility in various chemical and pharmaceutical contexts.
Formula:C10H9N3O
InChI:InChI=1S/C10H9N3O/c1-13-7-12-9-5-8(3-2-4-14)6-11-10(9)13/h5-7,14H,4H2,1H3
InChI key:InChIKey=NREKAEVUMVTRPE-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C#CCO)=CN2)N=C1
Synonyms:
  • 3-(3-Methyl-3H-imidazo[4,5-b]pyridin-6-yl)-2-propyn-1-ol
  • 2-Propyn-1-ol, 3-(3-methyl-3H-imidazo[4,5-b]pyridin-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.