CAS 1171920-75-4
:7-Bromo-2-(chloromethyl)-1-methyl-1H-imidazo[4,5-c]pyridine
Description:
7-Bromo-2-(chloromethyl)-1-methyl-1H-imidazo[4,5-c]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-c]pyridine core, which incorporates both bromine and chloromethyl substituents. This compound features a bromine atom at the 7-position and a chloromethyl group at the 2-position, along with a methyl group at the 1-position of the imidazole ring. The presence of these halogen substituents can influence its reactivity, making it potentially useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The imidazo[4,5-c]pyridine structure is known for its biological activity, often being explored in medicinal chemistry for its potential pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can vary based on the solvent and conditions used, which is crucial for applications in synthesis and drug development. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C8H7BrClN3
InChI:InChI=1S/C8H7BrClN3/c1-13-7(2-10)12-6-4-11-3-5(9)8(6)13/h3-4H,2H2,1H3
InChI key:InChIKey=MFEYYVPSWAZRET-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1CCl)=CN=CC2Br
Synonyms:- 1H-Imidazo[4,5-c]pyridine, 7-bromo-2-(chloromethyl)-1-methyl-
- 7-Bromo-2-(chloromethyl)-1-methyl-1H-imidazo[4,5-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.