CAS 1171921-57-5

2-Methoxy-6-(5-phenylpentyl)benzoic acid

Description:

2-Methoxy-6-(5-phenylpentyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group and a long alkyl chain attached to a benzoic acid moiety. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The phenylpentyl substituent contributes to the compound's hydrophobic characteristics, potentially affecting its pharmacokinetics and biological activity. This compound may exhibit properties typical of benzoic acids, such as acidity due to the carboxylic acid functional group (-COOH), which can participate in hydrogen bonding and influence its solubility in water. Additionally, the structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its unique combination of functional groups may also lead to interesting interactions in various chemical environments, making it a subject of interest for further research in organic synthesis and material science.

Formula: C₁₉H₂₂O₃

InChI: InChI=1S/C19H22O3/c1-22-17-14-8-13-16(18(17)19(20)21)12-7-3-6-11-15-9-4-2-5-10-15/h2,4-5,8-10,13-14H,3,6-7,11-12H2,1H3,(H,20,21)

InChI key: InChIKey=GJIBSWPRLZEEMK-UHFFFAOYSA-N

SMILES: C(CCCCC1=CC=CC=C1)C2=C(C(O)=O)C(OC)=CC=C2

Synonyms:

• 2-Methoxy-6-(5-phenylpentyl)benzoic acid
• Benzoic acid, 2-methoxy-6-(5-phenylpentyl)-