CAS 1171921-65-5

Methyl 2-methoxy-6-(3-phenoxypropyl)benzoate

Description:

Methyl 2-methoxy-6-(3-phenoxypropyl)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety, a methoxy group, and a phenoxypropyl substituent. This compound is typically classified as an ester, derived from the reaction of benzoic acid and methanol, with additional functional groups that enhance its chemical properties. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic phenyl groups, while its methoxy group may contribute to some polar characteristics. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could influence its behavior in various applications, such as in pharmaceuticals or agrochemicals. Additionally, the compound may possess biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by the substituents on the aromatic rings, which may affect its interactions with biological targets or its degradation pathways. Overall, Methyl 2-methoxy-6-(3-phenoxypropyl)benzoate represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₈H₂₀O₄

InChI: InChI=1S/C18H20O4/c1-20-16-12-6-8-14(17(16)18(19)21-2)9-7-13-22-15-10-4-3-5-11-15/h3-6,8,10-12H,7,9,13H2,1-2H3

InChI key: InChIKey=TWHCMMXGEKRFPN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(CCCOC2=CC=CC=C2)C=CC=C1OC

Synonyms:

• Methyl 2-methoxy-6-(3-phenoxypropyl)benzoate
• Benzoic acid, 2-methoxy-6-(3-phenoxypropyl)-, methyl ester