CAS 1171921-93-9

Methyl 4-methoxy-3-[3-[2-(3-methoxyphenyl)ethyl]phenoxy]benzoate

Description:

Methyl 4-methoxy-3-[3-[2-(3-methoxyphenyl)ethyl]phenoxy]benzoate, identified by its CAS number 1171921-93-9, is an organic compound characterized by its complex structure, which includes multiple aromatic rings and methoxy groups. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of methoxy groups enhances its lipophilicity and may influence its biological activity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to interact with biological targets. Additionally, the presence of multiple phenyl rings may impart stability and influence the compound's reactivity. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature typically exhibit moderate to high stability under standard conditions. Further studies would be necessary to elucidate its full range of chemical properties and potential applications.

Formula: C₂₄H₂₄O₅

InChI: InChI=1S/C24H24O5/c1-26-20-8-4-6-17(14-20)10-11-18-7-5-9-21(15-18)29-23-16-19(24(25)28-3)12-13-22(23)27-2/h4-9,12-16H,10-11H2,1-3H3

InChI key: InChIKey=OLSNVQNDWWLRMQ-UHFFFAOYSA-N

SMILES: O(C1=C(OC)C=CC(C(OC)=O)=C1)C2=CC(CCC3=CC(OC)=CC=C3)=CC=C2

Synonyms:

• Methyl 4-methoxy-3-[3-[2-(3-methoxyphenyl)ethyl]phenoxy]benzoate
• Benzoic acid, 4-methoxy-3-[3-[2-(3-methoxyphenyl)ethyl]phenoxy]-, methyl ester