CAS 1171923-11-7

4-Methoxy-3-pyridinepropanoic acid

Description:

4-Methoxy-3-pyridinepropanoic acid is an organic compound characterized by its pyridine ring and a propanoic acid functional group. The presence of a methoxy group at the 4-position of the pyridine ring contributes to its unique chemical properties, including potential solubility in organic solvents and moderate polarity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, such as esterification or amidation, due to the carboxylic acid group. The pyridine moiety may also influence its interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. Additionally, the compound's stability, reactivity, and potential applications in synthesis or as a building block in drug development can be influenced by the substituents on the pyridine ring. Overall, 4-Methoxy-3-pyridinepropanoic acid represents a versatile structure in organic chemistry with implications in medicinal chemistry and material science.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-13-8-4-5-10-6-7(8)2-3-9(11)12/h4-6H,2-3H2,1H3,(H,11,12)

InChI key: InChIKey=MFVWUQGKUKKNFB-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1C(OC)=CC=NC1

Synonyms:

• 3-Pyridinepropanoic acid, 4-methoxy-
• 4-Methoxy-3-pyridinepropanoic acid