CymitQuimica logo

CAS 1171923-23-1

:

Methyl 2-methoxy-6-[[[(1-phenylethylidene)amino]oxy]methyl]benzoate

Description:
Methyl 2-methoxy-6-[[[(1-phenylethylidene)amino]oxy]methyl]benzoate, identified by its CAS number 1171923-23-1, is an organic compound characterized by its complex structure, which includes a methoxy group, a benzoate moiety, and an aminooxy functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the methoxy group enhances its electron-donating characteristics, which can influence its reactivity in chemical reactions, particularly in electrophilic aromatic substitution. Additionally, the aminooxy group may participate in reactions involving nucleophiles, making it a candidate for various synthetic applications. Its structural features suggest potential biological activity, which could be explored in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents an interesting subject for further research in organic synthesis and potential applications in pharmaceuticals.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c1-13(14-8-5-4-6-9-14)19-23-12-15-10-7-11-16(21-2)17(15)18(20)22-3/h4-11H,12H2,1-3H3
InChI key:InChIKey=ZNUJFSIOCAIPDW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CON=C(C)C2=CC=CC=C2)C=CC=C1OC
Synonyms:
  • Benzoic acid, 2-methoxy-6-[[[(1-phenylethylidene)amino]oxy]methyl]-, methyl ester
  • Methyl 2-methoxy-6-[[[(1-phenylethylidene)amino]oxy]methyl]benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.