CAS 1171923-45-7

Methyl 2-[3-(2,4-dichlorophenyl)propyl]-6-methoxybenzoate

Description:

Methyl 2-[3-(2,4-dichlorophenyl)propyl]-6-methoxybenzoate, identified by its CAS number 1171923-45-7, is an organic compound characterized by its complex structure, which includes a methoxy group and a dichlorophenyl moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while having limited solubility in water due to its hydrophobic characteristics. The presence of the dichlorophenyl group suggests potential biological activity, which may be of interest in pharmaceutical applications. Additionally, the methoxy and ester functionalities can influence its reactivity and interactions with other chemical species. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can exhibit varied environmental and health impacts. Overall, this compound's unique structure may lend itself to various applications in organic synthesis and medicinal chemistry.

Formula: C₁₈H₁₈Cl₂O₃

InChI: InChI=1S/C18H18Cl2O3/c1-22-16-8-4-7-13(17(16)18(21)23-2)6-3-5-12-9-10-14(19)11-15(12)20/h4,7-11H,3,5-6H2,1-2H3

InChI key: InChIKey=RSDUAHVHNXQXAF-UHFFFAOYSA-N

SMILES: C(CCC1=C(Cl)C=C(Cl)C=C1)C2=C(C(OC)=O)C(OC)=CC=C2

Synonyms:

• Methyl 2-[3-(2,4-dichlorophenyl)propyl]-6-methoxybenzoate
• Benzoic acid, 2-[3-(2,4-dichlorophenyl)propyl]-6-methoxy-, methyl ester