CAS 1171923-46-8

2-Methoxy-6-[[(2-methylphenyl)methoxy]methyl]benzoic acid

Description:

2-Methoxy-6-[[(2-methylphenyl)methoxy]methyl]benzoic acid, identified by its CAS number 1171923-46-8, is an organic compound characterized by its complex structure, which includes a benzoic acid core substituted with methoxy and methylphenyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of methoxy groups can enhance its solubility in organic solvents and may influence its biological activity, potentially acting as a ligand in various chemical reactions. Additionally, the benzoic acid moiety suggests potential applications in pharmaceuticals or agrochemicals, where it may serve as an intermediate or active ingredient. Its molecular structure may also impart specific characteristics such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and van der Waals interactions. Overall, this compound's unique arrangement of functional groups contributes to its potential utility in various chemical and industrial applications.

Formula: C₁₇H₁₈O₄

InChI: InChI=1S/C17H18O4/c1-12-6-3-4-7-13(12)10-21-11-14-8-5-9-15(20-2)16(14)17(18)19/h3-9H,10-11H2,1-2H3,(H,18,19)

InChI key: InChIKey=JDLRXMYUOOAKCD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(COCC2=C(C)C=CC=C2)C=CC=C1OC

Synonyms:

• Benzoic acid, 2-methoxy-6-[[(2-methylphenyl)methoxy]methyl]-
• 2-Methoxy-6-[[(2-methylphenyl)methoxy]methyl]benzoic acid