CymitQuimica logo

CAS 1171923-49-1

:

Ethyl 2-methoxy-6-[[(2-methylphenyl)methoxy]methyl]benzoate

Description:
Ethyl 2-methoxy-6-[[(2-methylphenyl)methoxy]methyl]benzoate, identified by its CAS number 1171923-49-1, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group, methoxy groups, and a benzoate moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. Its molecular structure suggests potential applications in fields like pharmaceuticals or agrochemicals, where such derivatives may serve as intermediates or active ingredients. The presence of methoxy and methylphenyl groups may impart specific reactivity and biological activity, making it of interest for further research. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of its substituents. Overall, while specific physical and chemical properties such as boiling point, melting point, and spectral data would require empirical measurement, the structural characteristics provide insight into its potential behavior and applications in various chemical contexts.
Formula:C19H22O4
InChI:InChI=1S/C19H22O4/c1-4-23-19(20)18-16(10-7-11-17(18)21-3)13-22-12-15-9-6-5-8-14(15)2/h5-11H,4,12-13H2,1-3H3
InChI key:InChIKey=NGCKEYRYKGRTSG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(COCC2=C(C)C=CC=C2)C=CC=C1OC
Synonyms:
  • Benzoic acid, 2-methoxy-6-[[(2-methylphenyl)methoxy]methyl]-, ethyl ester
  • Ethyl 2-methoxy-6-[[(2-methylphenyl)methoxy]methyl]benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.