
CAS 1171923-81-1
:3-[4-(Benzoyloxy)phenyl]-1-[2,4-bis(benzoyloxy)-6-hydroxyphenyl]-2-propen-1-one
Description:
The chemical substance known as 3-[4-(Benzoyloxy)phenyl]-1-[2,4-bis(benzoyloxy)-6-hydroxyphenyl]-2-propen-1-one, with the CAS number 1171923-81-1, is a synthetic organic compound characterized by its complex structure, which includes multiple benzoyloxy groups and a hydroxyphenyl moiety. This compound belongs to the class of chalcones, which are known for their potential biological activities, including anti-inflammatory, antioxidant, and anticancer properties. The presence of hydroxyl groups in its structure may enhance its reactivity and solubility in polar solvents. Additionally, the benzoyloxy substituents can influence its lipophilicity and overall stability. The compound's unique arrangement of functional groups suggests that it may exhibit interesting photophysical properties, making it a candidate for further research in medicinal chemistry and materials science. Its synthesis and characterization would typically involve standard organic reactions, including acylation and condensation processes, to achieve the desired structural features.
Formula:C36H24O8
InChI:InChI=1S/C36H24O8/c37-30(21-18-24-16-19-28(20-17-24)42-34(39)25-10-4-1-5-11-25)33-31(38)22-29(43-35(40)26-12-6-2-7-13-26)23-32(33)44-36(41)27-14-8-3-9-15-27/h1-23,38H
InChI key:InChIKey=AZKRWNARJSVRQM-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=CC=C1)C2=C(C(C=CC3=CC=C(OC(=O)C4=CC=CC=C4)C=C3)=O)C(O)=CC(OC(=O)C5=CC=CC=C5)=C2
Synonyms:- 2-Propen-1-one, 3-[4-(benzoyloxy)phenyl]-1-[2,4-bis(benzoyloxy)-6-hydroxyphenyl]-
- 3-[4-(Benzoyloxy)phenyl]-1-[2,4-bis(benzoyloxy)-6-hydroxyphenyl]-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.