
CAS 1171923-86-6
:2-[3-(3,4-Dichlorophenyl)propyl]-6-methoxybenzoic acid
Description:
2-[3-(3,4-Dichlorophenyl)propyl]-6-methoxybenzoic acid, identified by its CAS number 1171923-86-6, is a chemical compound that belongs to the class of benzoic acids. This substance features a complex structure characterized by a benzoic acid moiety substituted with a methoxy group at the 6-position and a propyl chain linked to a dichlorophenyl group at the 2-position. The presence of the dichlorophenyl group imparts significant hydrophobic characteristics, while the methoxy group contributes to its overall polarity. This compound may exhibit biological activity, potentially influencing various biochemical pathways, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, the unique structural features of this compound suggest potential applications in medicinal chemistry and related fields.
Formula:C17H16Cl2O3
InChI:InChI=1S/C17H16Cl2O3/c1-22-15-7-3-6-12(16(15)17(20)21)5-2-4-11-8-9-13(18)14(19)10-11/h3,6-10H,2,4-5H2,1H3,(H,20,21)
InChI key:InChIKey=YOQJWIFSDDHBTL-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=C(Cl)C=C1)C2=C(C(O)=O)C(OC)=CC=C2
Synonyms:- 2-[3-(3,4-Dichlorophenyl)propyl]-6-methoxybenzoic acid
- Benzoic acid, 2-[3-(3,4-dichlorophenyl)propyl]-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.