
CAS 1171923-87-7
:Ethyl 2-methoxy-6-[(phenylmethoxy)methyl]benzoate
Description:
Ethyl 2-methoxy-6-[(phenylmethoxy)methyl]benzoate, identified by its CAS number 1171923-87-7, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a methoxy group and a phenylmethoxy substituent, contributing to its complexity and potential for various chemical interactions. It typically appears as a colorless to pale yellow liquid with a pleasant aroma, indicative of its aromatic structure. The presence of multiple functional groups suggests that it may exhibit interesting solubility properties, likely being soluble in organic solvents while having limited solubility in water. Its molecular structure implies potential applications in fields such as pharmaceuticals, fragrances, or as an intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring, making it a subject of interest for further research in synthetic chemistry and material science. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C18H20O4
InChI:InChI=1S/C18H20O4/c1-3-22-18(19)17-15(10-7-11-16(17)20-2)13-21-12-14-8-5-4-6-9-14/h4-11H,3,12-13H2,1-2H3
InChI key:InChIKey=XLWBKEYRMBMOGY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(COCC2=CC=CC=C2)C=CC=C1OC
Synonyms:- Ethyl 2-methoxy-6-[(phenylmethoxy)methyl]benzoate
- Benzoic acid, 2-methoxy-6-[(phenylmethoxy)methyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.