
CAS 1171924-00-7
:2-Methoxy-6-[2-(1-naphthalenyl)ethyl]benzoic acid
Description:
2-Methoxy-6-[2-(1-naphthalenyl)ethyl]benzoic acid is an organic compound characterized by its complex structure, which includes a methoxy group, a naphthalene moiety, and a carboxylic acid functional group. This compound features a benzoic acid backbone, which contributes to its acidity and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The naphthyl ethyl substituent can impart unique electronic and steric properties, potentially affecting its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring compounds with specific binding affinities or biological activities. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Proper handling and storage are essential to maintain its integrity for research or industrial applications.
Formula:C20H18O3
InChI:InChI=1S/C20H18O3/c1-23-18-11-5-9-16(19(18)20(21)22)13-12-15-8-4-7-14-6-2-3-10-17(14)15/h2-11H,12-13H2,1H3,(H,21,22)
InChI key:InChIKey=RRYWAHGJHFFHGD-UHFFFAOYSA-N
SMILES:C(CC1=C(C(O)=O)C(OC)=CC=C1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- 2-Methoxy-6-[2-(1-naphthalenyl)ethyl]benzoic acid
- Benzoic acid, 2-methoxy-6-[2-(1-naphthalenyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.