
CAS 1171924-07-4
:Ethyl 2-methoxy-6-[(nitrooxy)methyl]benzoate
Description:
Ethyl 2-methoxy-6-[(nitrooxy)methyl]benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a methoxy group (-OCH3) and a nitrooxy group (-ONO2) attached to a benzene ring, contributing to its unique chemical properties. The presence of the nitrooxy group suggests potential applications in the field of explosives or propellants, as nitro compounds are often associated with energetic materials. The ethyl ester component indicates that it may exhibit moderate volatility and solubility in organic solvents. Additionally, the methoxy group can influence the compound's reactivity and polarity, potentially affecting its interactions in various chemical environments. Overall, the structural features of Ethyl 2-methoxy-6-[(nitrooxy)methyl]benzoate suggest it may have applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its properties and behavior under different conditions.
Formula:C11H13NO6
InChI:InChI=1S/C11H13NO6/c1-3-17-11(13)10-8(7-18-12(14)15)5-4-6-9(10)16-2/h4-6H,3,7H2,1-2H3
InChI key:InChIKey=HBAJWJKGKJAVLL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(CON(=O)=O)C=CC=C1OC
Synonyms:- Benzoic acid, 2-methoxy-6-[(nitrooxy)methyl]-, ethyl ester
- Ethyl 2-methoxy-6-[(nitrooxy)methyl]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.