CymitQuimica logo

CAS 1171924-35-8

:

2-Hydroxy-6-[(phenylthio)methyl]benzoic acid

Description:
2-Hydroxy-6-[(phenylthio)methyl]benzoic acid, identified by its CAS number 1171924-35-8, is an organic compound characterized by the presence of a hydroxyl group and a carboxylic acid functional group on a benzoic acid framework. The compound features a phenylthio group, which contributes to its unique chemical properties and potential reactivity. This structure suggests that it may exhibit both acidic and polar characteristics due to the carboxylic acid and hydroxyl functionalities, respectively. The presence of the phenylthio group can enhance lipophilicity and influence the compound's solubility in organic solvents. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, affecting its interactions in biological systems or chemical reactions. Its specific applications may vary, but compounds of this nature are often explored in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications would depend on the surrounding conditions and the presence of other functional groups.
Formula:C14H12O3S
InChI:InChI=1S/C14H12O3S/c15-12-8-4-5-10(13(12)14(16)17)9-18-11-6-2-1-3-7-11/h1-8,15H,9H2,(H,16,17)
InChI key:InChIKey=YLAXWQBBDJBRJK-UHFFFAOYSA-N
SMILES:C(SC1=CC=CC=C1)C2=C(C(O)=O)C(O)=CC=C2
Synonyms:
  • 2-Hydroxy-6-[(phenylthio)methyl]benzoic acid
  • Benzoic acid, 2-hydroxy-6-[(phenylthio)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.