CAS 1171924-38-1

Methyl 2-[2-(1H-indol-3-yl)ethenyl]-6-methoxybenzoate

Description:

Methyl 2-[2-(1H-indol-3-yl)ethenyl]-6-methoxybenzoate, identified by its CAS number 1171924-38-1, is an organic compound characterized by its complex structure, which includes an indole moiety and a methoxy-substituted benzoate group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic characteristics. The presence of the indole ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. Its synthesis may involve standard organic reactions such as esterification and alkene formation. Overall, this compound's unique structural features may confer specific chemical reactivity and biological activity, warranting further investigation in research contexts.

Formula: C₁₉H₁₇NO₃

InChI: InChI=1S/C19H17NO3/c1-22-17-9-5-6-13(18(17)19(21)23-2)10-11-14-12-20-16-8-4-3-7-15(14)16/h3-12,20H,1-2H3

InChI key: InChIKey=VSSMMQMINJYYQD-UHFFFAOYSA-N

SMILES: C(=CC1=C(C(OC)=O)C(OC)=CC=C1)C=2C=3C(NC2)=CC=CC3

Synonyms:

• Benzoic acid, 2-[2-(1H-indol-3-yl)ethenyl]-6-methoxy-, methyl ester
• Methyl 2-[2-(1H-indol-3-yl)ethenyl]-6-methoxybenzoate