CAS 1171924-70-1

2-Hydroxy-6-[(2-phenylethoxy)methyl]benzoic acid

Description:

2-Hydroxy-6-[(2-phenylethoxy)methyl]benzoic acid, identified by its CAS number 1171924-70-1, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group and a carboxylic acid functional group. This compound features a phenylethoxy side chain that contributes to its hydrophobic properties, enhancing its solubility in organic solvents. The presence of the hydroxyl group imparts polar characteristics, allowing for potential hydrogen bonding interactions. As a benzoic acid derivative, it may exhibit acidic behavior, making it relevant in various chemical reactions, particularly in esterification and amidation processes. Its structural features suggest potential applications in pharmaceuticals, particularly as an intermediate in drug synthesis or as a bioactive compound. Additionally, the compound's unique combination of functional groups may influence its biological activity, making it a candidate for further research in medicinal chemistry. Overall, 2-Hydroxy-6-[(2-phenylethoxy)methyl]benzoic acid presents a blend of hydrophilic and hydrophobic characteristics, which can be leveraged in various chemical and biological applications.

Formula: C₁₆H₁₆O₄

InChI: InChI=1S/C16H16O4/c17-14-8-4-7-13(15(14)16(18)19)11-20-10-9-12-5-2-1-3-6-12/h1-8,17H,9-11H2,(H,18,19)

InChI key: InChIKey=UMSSXPZCCQXFLR-UHFFFAOYSA-N

SMILES: C(OCCC1=CC=CC=C1)C2=C(C(O)=O)C(O)=CC=C2

Synonyms:

• 2-Hydroxy-6-(phenethoxymethyl)benzoic acid
• Benzoic acid, 2-hydroxy-6-[(2-phenylethoxy)methyl]-
• 2-Hydroxy-6-[(2-phenylethoxy)methyl]benzoic acid