CAS 1171924-98-3

Methyl 2-[2-(9-anthracenyl)ethyl]-6-hydroxybenzoate

Description:

Methyl 2-[2-(9-anthracenyl)ethyl]-6-hydroxybenzoate is an organic compound characterized by its complex structure, which includes an anthracene moiety, a hydroxy group, and an ester functional group. This compound features a methyl ester derived from a benzoic acid, specifically substituted at the 2-position with a 2-(9-anthracenyl)ethyl group and at the 6-position with a hydroxy group. The presence of the anthracene unit suggests potential applications in organic electronics and photonics due to its conjugated system, which can facilitate light absorption and emission. The hydroxy group contributes to the compound's solubility and reactivity, potentially allowing for hydrogen bonding interactions. Additionally, the ester functionality may influence its stability and reactivity in various chemical environments. Overall, this compound's unique structural features make it of interest in fields such as materials science and medicinal chemistry, where its photophysical properties can be exploited for various applications.

Formula: C₂₄H₂₀O₃

InChI: InChI=1S/C24H20O3/c1-27-24(26)23-16(9-6-12-22(23)25)13-14-21-19-10-4-2-7-17(19)15-18-8-3-5-11-20(18)21/h2-12,15,25H,13-14H2,1H3

InChI key: InChIKey=PNCQRYXRARFHCJ-UHFFFAOYSA-N

SMILES: C(CC1=C(C(OC)=O)C(O)=CC=C1)C=2C3=C(C=C4C2C=CC=C4)C=CC=C3

Synonyms:

• Methyl 2-[2-(9-anthracenyl)ethyl]-6-hydroxybenzoate
• Benzoic acid, 2-[2-(9-anthracenyl)ethyl]-6-hydroxy-, methyl ester