CAS 1171936-13-2

4-Amino-6,8-dimethyl-3-quinolinecarboxylic acid

Description:

4-Amino-6,8-dimethyl-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of two methyl groups at the 6 and 8 positions of the quinoline ring influences its solubility and reactivity. Typically, compounds of this nature may exhibit various biological activities, including antimicrobial or antitumor properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, and the functional groups can participate in hydrogen bonding, enhancing its reactivity. Additionally, the compound's stability and behavior in different solvents can vary based on pH and temperature, which are important considerations in its application in research or pharmaceuticals. Overall, 4-Amino-6,8-dimethyl-3-quinolinecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1S/C12H12N2O2/c1-6-3-7(2)11-8(4-6)10(13)9(5-14-11)12(15)16/h3-5H,1-2H3,(H2,13,14)(H,15,16)

InChI key: InChIKey=GLGYJXDKOKYSSS-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1C(O)=O)C(C)=CC(C)=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-6,8-dimethyl-
• 4-Amino-6,8-dimethyl-3-quinolinecarboxylic acid
• 4-Amino-6,8-dimethylquinoline-3-carboxylic acid