CAS 1172006-29-9

Morpholine, 2-(4-methylphenyl)-, ethanedioate (1:1)

Description:

Morpholine, 2-(4-methylphenyl)-, ethanedioate (1:1), identified by CAS number 1172006-29-9, is a chemical compound that features a morpholine ring substituted with a 4-methylphenyl group and is associated with ethanedioic acid (oxalic acid) in a 1:1 stoichiometric ratio. This compound typically exhibits characteristics common to morpholine derivatives, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is likely to be soluble in polar organic solvents due to the presence of the morpholine moiety, which enhances its ability to interact with various chemical environments. The presence of the ethanedioate component suggests potential applications in organic synthesis or as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and potential hazards, as morpholine derivatives can have varying toxicity profiles.

Formula: C₁₁H₁₅NO·C₂H₂O₄

InChI: InChI=1S/C11H15NO.C2H2O4/c1-9-2-4-10(5-3-9)11-8-12-6-7-13-11;3-1(4)2(5)6/h2-5,11-12H,6-8H2,1H3;(H,3,4)(H,5,6)

InChI key: InChIKey=LJOJKVKVTFVRQJ-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)C2CNCCO2.C(C(O)=O)(O)=O

Synonyms:

• Morpholine, 2-(4-methylphenyl)-, ethanedioate (1:1)

2-(4-methylphenyl)morpholine oxalate

CAS: 1172006-29-9

2-(4-methylphenyl)morpholine oxalate

Purity: ≥95%

Molecular weight: 0.00g/mol

Ref: 54-OR12832