CAS 117204-81-6

5,7-dihydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-2,3-dihydro-4H-chromen-4-one

Description:

5,7-Dihydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-2,3-dihydro-4H-chromen-4-one, with CAS number 117204-81-6, is a flavonoid compound characterized by its complex polyphenolic structure. This substance features multiple hydroxyl groups, which contribute to its potential antioxidant properties, and a methoxy group that may enhance its solubility and bioactivity. The presence of a chromenone core indicates that it belongs to the flavonoid family, which is known for various biological activities, including anti-inflammatory and anticancer effects. The specific substituents on the phenyl rings suggest that this compound may exhibit unique interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the presence of a 3-methylbut-2-en-1-yl group indicates a level of structural complexity that may affect its stability and reactivity. Overall, this compound's unique structure positions it as a subject of interest for further research in medicinal chemistry and natural product studies.

Formula: C₂₁H₂₂O₆

InChI: InChI=1/C21H22O6/c1-11(2)4-5-14-16(23)7-6-13(21(14)26-3)15-10-27-18-9-12(22)8-17(24)19(18)20(15)25/h4,6-9,15,22-24H,5,10H2,1-3H3

SMILES: CC(=CCc1c(ccc(C2COc3cc(cc(c3C2=O)O)O)c1OC)O)C

Synonyms:

• Sophora-iso-flavanone A

SophoraisoflavoneA

CAS: 117204-81-6

Formula: C₂₀H₁₆O₆

Molecular weight: 352.3374

Ref: IN-DA0092XD

Sophoraisoflavone A

CAS: 117204-81-6

Sophoraisoflavone A inhibits MRP and AM fungus growth, blocking germ tube formation at 1.25 ug/disc and preventing copper-induced brain oxidation.

Formula: C₂₀H₁₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 352.34

Ref: TM-TN2219

Sophoraisoflavone A

CAS: 117204-81-6

Formula: C₂₀H₁₆O₆

Purity: 95%~99%

Molecular weight: 352.342

Ref: BP-SBP03493

Sophoraisoflavone A

CAS: 117204-81-6

Sophoraisoflavone A is a phytochemical compound classified as an isoflavone, which is primarily derived from various species of the Sophora plant, particularly within the Leguminosae family. This compound is known for its bioactive properties, attributed to its complex molecular structure. The primary mode of action of Sophoraisoflavone A involves modulation of cellular signaling pathways, antioxidant activity, and interaction with various biological targets, contributing to its potential therapeutic effects.

Formula: C₂₀H₁₆O₆

Purity: Min. 95%

Molecular weight: 352.3 g/mol

Ref: 3D-SEA20481