CAS 1172048-86-0

7-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)[1,2,4]triazolo[1,5-a]pyrimidine-2-propanoic acid

Description:

7-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)[1,2,4]triazolo[1,5-a]pyrimidine-2-propanoic acid is a chemical compound characterized by its complex heterocyclic structure, which includes a combination of pyrazole, triazole, and pyrimidine rings. This compound features a propanoic acid functional group, contributing to its potential as a bioactive molecule. The presence of multiple nitrogen atoms within its rings suggests that it may exhibit interesting pharmacological properties, possibly including anti-inflammatory or anti-cancer activities. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall electronic configuration. Additionally, its CAS number, 1172048-86-0, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical databases. Overall, this compound represents a significant area of interest in the development of new therapeutic agents.

Formula: C₁₄H₁₆N₆O₂

InChI: InChI=1S/C14H16N6O2/c1-3-19-8-10(9(2)17-19)11-6-7-15-14-16-12(18-20(11)14)4-5-13(21)22/h6-8H,3-5H2,1-2H3,(H,21,22)

InChI key: InChIKey=BSFQJIPUOTWQLQ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=NN2C(=CC=NC2=N1)C3=CN(CC)N=C3C

Synonyms:

• 7-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)[1,2,4]triazolo[1,5-a]pyrimidine-2-propanoic acid
• [1,2,4]Triazolo[1,5-a]pyrimidine-2-propanoic acid, 7-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-

3-[7-(1-Ethyl-3-methyl-1H-pyrazol-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propanoic acid

CAS: 1172048-86-0

Versatile small molecule scaffold

Formula: C₁₄H₁₆N₆O₂

Purity: Min. 95%

Molecular weight: 300.32 g/mol

Ref: 3D-XWB04886