CAS 117211-21-9
:N-[(3-Chlorophenyl)phenylmethyl]urea
Description:
N-[(3-Chlorophenyl)phenylmethyl]urea, identified by its CAS number 117211-21-9, is a chemical compound characterized by its urea functional group, which is linked to a phenylmethyl moiety and a chlorophenyl substituent. This compound typically exhibits solid-state properties at room temperature and is often utilized in pharmaceutical research due to its potential biological activity. The presence of the chlorine atom on the aromatic ring can influence its reactivity and solubility, making it of interest in medicinal chemistry. Its molecular structure suggests that it may engage in hydrogen bonding due to the urea group, which can affect its interactions with biological targets. Additionally, the compound's lipophilicity and steric factors are important for its pharmacokinetic properties. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, N-[(3-Chlorophenyl)phenylmethyl]urea represents a class of compounds that may have significant implications in drug development and chemical synthesis.
Formula:C14H13ClN2O
InChI:InChI=1S/C14H13ClN2O/c15-12-8-4-7-11(9-12)13(17-14(16)18)10-5-2-1-3-6-10/h1-9,13H,(H3,16,17,18)
InChI key:InChIKey=VQPUSIQKYOCUMK-UHFFFAOYSA-N
SMILES:C(NC(N)=O)(C1=CC(Cl)=CC=C1)C2=CC=CC=C2
Synonyms:- Urea, N-[(3-chlorophenyl)phenylmethyl]-
- N-[(3-Chlorophenyl)phenylmethyl]urea
- Urea, [(3-chlorophenyl)phenylmethyl]-
- (m-Chlorodiphenylmethyl)urea
- [(3-Chlorophenyl)phenylmethyl]urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
