CAS 117229-60-4
:2-methyl-4-carboxy-5-hydroxy-3,4,5,6-tetrahydropyrimidine
Description:
2-Methyl-4-carboxy-5-hydroxy-3,4,5,6-tetrahydropyrimidine, with the CAS number 117229-60-4, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group and a carboxylic acid group, contributing to its polar nature and potential solubility in polar solvents. The presence of a hydroxyl group enhances its reactivity and ability to participate in hydrogen bonding, which can influence its biological activity and interactions with other molecules. The tetrahydropyrimidine framework indicates that it is a saturated derivative of pyrimidine, which may affect its stability and reactivity compared to unsaturated analogs. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can mimic biological molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination for precise applications in research and industry.
Formula:C6H10N2O3
InChI:InChI=1/C6H10N2O3/c1-3-7-2-4(9)5(8-3)6(10)11/h4-5,9H,2H2,1H3,(H,7,8)(H,10,11)
SMILES:CC1=NCC(C(C(=O)O)N1)O
Synonyms:- 1,4,5,6-Tetrahydro-5-hydroxy-2-methyl-4-pyrimidinecarboxylic acid
- Thp(A)
- 4-Pyrimidinecarboxylic acid, 1,4,5,6-tetrahydro-5-hydroxy-2-methyl-
- 5-Hydroxy-2-Methyl-3,4,5,6-Tetrahydropyrimidine-4-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Hydroxy-2-methyl-1,4,5,6-tetrahydropyrimidine-4-carboxylic acid
CAS:Formula:C6H10N2O3Molecular weight:158.1552
