CAS 117233-43-9
:N-{5-[(3-{[N~5~-(diaminomethylidene)ornithyl]amino}propyl)amino]pentyl}-N~2~-[(4-hydroxy-1H-indol-3-yl)acetyl]-N~6~-methyllysinamide
Description:
The chemical substance N-{5-[(3-{[N~5~-(diaminomethylidene)ornithyl]amino}propyl)amino]pentyl}-N~2~-[(4-hydroxy-1H-indol-3-yl)acetyl]-N~6~-methyllysinamide, with CAS number 117233-43-9, is a complex organic compound characterized by its multi-functional structure, which includes amino acids and indole derivatives. This compound features a series of amino groups, which contribute to its potential as a peptide or protein analog, and may exhibit biological activity due to the presence of the indole moiety, commonly associated with various pharmacological properties. The presence of hydroxyl and acetyl groups suggests potential for interactions with biological targets, possibly influencing solubility and reactivity. Its intricate structure indicates that it may participate in various biochemical pathways, making it of interest in medicinal chemistry and drug development. The specific arrangement of functional groups also implies that it could be involved in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy and stability. Overall, this compound represents a significant area of study in the context of therapeutic applications.
Formula:C31H54N10O4
InChI:InChI=1/C31H54N10O4/c1-35-14-6-3-11-25(41-27(43)20-22-21-40-24-12-7-13-26(42)28(22)24)30(45)38-17-5-2-4-15-36-16-9-19-37-29(44)23(32)10-8-18-39-31(33)34/h7,12-13,21,23,25,35-36,40,42H,2-6,8-11,14-20,32H2,1H3,(H,37,44)(H,38,45)(H,41,43)(H4,33,34,39)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Argiopinin IV
CAS:<p>Argiopinin IV is a peptide, which is sourced from the venom of orb-weaver spiders, specifically in the Araneidae family. This peptide functions by modulating ion channels, particularly acting on voltage-gated calcium channels to alter neuronal signaling. Its ability to interfere with these channels suggests a potential to influence synaptic transmission and neuroprotection.</p>Formula:C31H54N10O4Purity:Min. 95%Molecular weight:630.8 g/mol
