CAS 117241-61-9

6,11-Dihydro-3,8,10,12-tetrahydroxy-1-methyl-6,11-dioxo-2-naphthacenecarboxylic acid

Description:

6,11-Dihydro-3,8,10,12-tetrahydroxy-1-methyl-6,11-dioxo-2-naphthacenecarboxylic acid, with the CAS number 117241-61-9, is a complex organic compound characterized by its naphthalene-derived structure, which includes multiple hydroxyl (–OH) groups and dioxo functionalities. This compound exhibits significant polarity due to the presence of hydroxyl groups, which can enhance its solubility in polar solvents. The dioxo groups contribute to its potential reactivity, making it a candidate for various chemical transformations. Its structural features suggest potential applications in pharmaceuticals or as a biochemical probe, given the importance of naphthalene derivatives in medicinal chemistry. Additionally, the presence of multiple functional groups may impart interesting biological activities, although specific biological properties would require further investigation. Overall, this compound represents a unique scaffold that could be explored for its chemical reactivity and potential applications in various fields, including drug development and materials science.

Formula: C₂₀H₁₂O₈

InChI: InChI=1S/C20H12O8/c1-6-13-7(3-11(22)14(6)20(27)28)2-9-16(18(13)25)19(26)15-10(17(9)24)4-8(21)5-12(15)23/h2-5,21-23,25H,1H3,(H,27,28)

InChI key: InChIKey=OXCNORDLEQIUCT-UHFFFAOYSA-N

SMILES: OC1=C2C(C(=O)C=3C(C2=O)=C(O)C=C(O)C3)=CC=4C1=C(C)C(C(O)=O)=C(O)C4

Synonyms:

• Tcm D 3
• 6,11-Dihydro-3,8,10,12-tetrahydroxy-1-methyl-6,11-dioxo-2-naphthacenecarboxylic acid
• 2-Naphthacenecarboxylic acid, 6,11-dihydro-3,8,10,12-tetrahydroxy-1-methyl-6,11-dioxo-
• Tetracenomycin D3

2-Naphthacenecarboxylic acid, 6,11-dihydro-3,8,10,12-tetrahydroxy-1-methyl-6,11-dioxo-

CAS: 117241-61-9

Formula: C₂₀H₁₂O₈

Molecular weight: 380.3045

Ref: IN-DA000DZQ