
CAS 117241-62-0
:6,11-Dihydro-3,10,12-trihydroxy-8-methoxy-1-methyl-6,11-dioxo-2-naphthacenecarboxylic acid
Description:
6,11-Dihydro-3,10,12-trihydroxy-8-methoxy-1-methyl-6,11-dioxo-2-naphthacenecarboxylic acid, with the CAS number 117241-62-0, is a complex organic compound characterized by its naphthalene-derived structure, which features multiple functional groups including hydroxyl (-OH), methoxy (-OCH3), and carboxylic acid (-COOH) groups. This compound exhibits properties typical of polyhydroxylated naphthalene derivatives, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to its hydroxyl groups. The presence of dioxo groups suggests it may have significant reactivity, particularly in redox reactions. Its structural features may confer biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, the methoxy group can influence the compound's lipophilicity and overall biological interactions. Overall, this compound's unique structure and functional groups contribute to its potential applications in various chemical and biological contexts.
Formula:C21H14O8
InChI:InChI=1S/C21H14O8/c1-7-14-8(4-12(22)15(7)21(27)28)3-10-17(19(14)25)20(26)16-11(18(10)24)5-9(29-2)6-13(16)23/h3-6,22-23,25H,1-2H3,(H,27,28)
InChI key:InChIKey=NSKLWYCTXNPUBB-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C(O)C=3C(C2)=CC(O)=C(C(O)=O)C3C)C(=O)C=4C1=CC(OC)=CC4O
Synonyms:- Tcm B 3
- 6,11-Dihydro-3,10,12-trihydroxy-8-methoxy-1-methyl-6,11-dioxo-2-naphthacenecarboxylic acid
- Tetracenomycin B3
- 2-Naphthacenecarboxylic acid, 6,11-dihydro-3,10,12-trihydroxy-8-methoxy-1-methyl-6,11-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Naphthacenecarboxylic acid, 6,11-dihydro-3,10,12-trihydroxy-8-methoxy-1-methyl-6,11-dioxo-
CAS:Formula:C21H14O8Molecular weight:394.3311
