CAS 117269-71-3
:2-IODOBENZYLZINC BROMIDE 0.5M IN THF
Description:
2-Iodobenzylzinc bromide, with the CAS number 117269-71-3, is an organozinc compound commonly used in organic synthesis, particularly in cross-coupling reactions. This compound typically exists as a colorless to light yellow solution when dissolved in tetrahydrofuran (THF), a polar aprotic solvent that facilitates the reactivity of organozinc reagents. The presence of the iodine atom enhances its reactivity, allowing it to participate in nucleophilic substitution and coupling reactions with various electrophiles. As a reagent, it is valued for its ability to form carbon-carbon bonds, making it useful in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. The 0.5M concentration indicates a moderate level of reactivity, suitable for many synthetic applications. However, like many organometallic compounds, it must be handled with care due to its sensitivity to moisture and air, which can lead to decomposition or undesired reactions. Proper storage and handling protocols are essential to maintain its stability and effectiveness in synthetic procedures.
Formula:C7H6BrIZn
InChI:InChI=1/C7H6I.BrH.Zn/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6BrIZn/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5H2
SMILES:C=C1[CH]C=CC=C1I.Br.[Zn]
Synonyms:- 2-Iodobenzylzinc Bromide Solution
- Bromo-[(2-Iodophenyl)Methyl]Zinc
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
