CAS 117271-77-9: CYCLOBIS(PARAQUAT-1,4-PHENYLENE) TETRAKIS(HEXAFLUOROPHOSPHATE)
Description:Cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate), with the CAS number 117271-77-9, is a synthetic organic compound notable for its unique structural and electronic properties. This substance features a cyclobis(paraquat) framework, which consists of paraquat units linked by phenylene groups, and is coordinated with hexafluorophosphate anions. The presence of multiple hexafluorophosphate groups contributes to its high ionic character and solubility in polar solvents. The compound exhibits interesting redox properties, making it a subject of study in fields such as supramolecular chemistry and materials science. Its ability to form stable complexes and its potential applications in molecular electronics and as a redox-active material are of particular interest. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and solvent polarity. Overall, cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate) represents a fascinating example of how molecular design can lead to materials with tailored properties for advanced applications.
Formula:C36H32F24N4P4
InChI:InChI=1/C36H32N4.4F6P/c1-2-30-4-3-29(1)25-37-17-9-33(10-18-37)35-13-21-39(22-14-35)27-31-5-7-32(8-6-31)28-40-23-15-36(16-24-40)34-11-19-38(26-30)20-12-34;4*1-7(2,3,4,5)6/h1-24H,25-28H2;;;;/q+4;4*-1
- Synonyms:
- 5,12,19,26-Tetraazoniaheptacyclo[24.2.2.2~2,5~.2~7,10~.2~12,15~.2~16,19~.2~21,24~]tetraconta-1(28),2,4,7,9,12,14,16,18,21,23,26,29,31,33,35,37,39-octadecaene tetrahexafluorophosphate

Cyclobis(paraquat-1,4-phenylene) Tetrakis(hexafluorophosphate)
Ref: 3B-C1749
100mg | 681.00 € |

5,12,19,26-Tetraazoniaheptacyclo[24.2.2.22,5.27,10.212,15.216,19.221,24]tetraconta-2,4,7,9,12,14,16,18,21,23,26,28,29,31,33,35,37,39-octadecaene, hexafluorophosphate(1-) (1:4)
Ref: IN-DA000E12
5mg | 176.00 € | ||
10mg | 165.00 € | ||
25mg | 486.00 € |

Cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate)
Ref: 3D-FC62108
2mg | 185.00 € | ||
5mg | 342.00 € | ||
10mg | 468.00 € | ||
25mg | 880.00 € | ||
50mg | 1,052.00 € |