CAS 117271-77-9
:CYCLOBIS(PARAQUAT-1,4-PHENYLENE) TETRAKIS(HEXAFLUOROPHOSPHATE)
Description:
Cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate), with the CAS number 117271-77-9, is a synthetic organic compound notable for its unique structural and electronic properties. This substance features a cyclobis(paraquat) framework, which consists of paraquat units linked by phenylene groups, and is coordinated with hexafluorophosphate anions. The presence of multiple hexafluorophosphate groups contributes to its high ionic character and solubility in polar solvents. The compound exhibits interesting redox properties, making it a subject of study in fields such as supramolecular chemistry and materials science. Its ability to form stable complexes and its potential applications in molecular electronics and as a redox-active material are of particular interest. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and solvent polarity. Overall, cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate) represents a fascinating example of how molecular design can lead to materials with tailored properties for advanced applications.
Formula:C36H32F24N4P4
InChI:InChI=1/C36H32N4.4F6P/c1-2-30-4-3-29(1)25-37-17-9-33(10-18-37)35-13-21-39(22-14-35)27-31-5-7-32(8-6-31)28-40-23-15-36(16-24-40)34-11-19-38(26-30)20-12-34;4*1-7(2,3,4,5)6/h1-24H,25-28H2;;;;/q+4;4*-1
Synonyms:- 5,12,19,26-Tetraazoniaheptacyclo[24.2.2.2~2,5~.2~7,10~.2~12,15~.2~16,19~.2~21,24~]tetraconta-1(28),2,4,7,9,12,14,16,18,21,23,26,29,31,33,35,37,39-octadecaene tetrahexafluorophosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclobis(paraquat-1,4-phenylene) Tetrakis(hexafluorophosphate)
CAS:Formula:C36H32F24N4P4Purity:>94.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:1,100.545,12,19,26-Tetraazoniaheptacyclo[24.2.2.22,5.27,10.212,15.216,19.221,24]tetraconta-2,4,7,9,12,14,16,18,21,23,26,28,29,31,33,35,37,39-octadecaene, hexafluorophosphate(1-) (1:4)
CAS:Formula:C36H32F24N4P4Purity:94%Color and Shape:SolidMolecular weight:1100.5228Cyclobis(paraquat-1,4-phenylene) Tetrakis(hexafluorophosphate)
CAS:Cyclobis(paraquat-1,4-phenylene) Tetrakis(hexafluorophosphate)Purity:>94.0%Cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate)
CAS:Cyclobis(paraquat-1,4-phenylene) tetrakis(hexafluorophosphate) (CPQTF) is a polyether that has been shown to have antiviral and anti-inflammatory properties. CPQTF is a chiral molecule which has the ability to form filaments at high temperatures. The temperature at which this polymer changes from a liquid to a filament is dependent on the concentration of polymer in solution. CPQTF has also been shown to have coagulation properties and can be used in cosmetics.Formula:C36H32F24N4P4Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,100.52 g/mol




