
CAS 1172746-65-4
:6-Bromo-3-chlorobenzo[b]thiophene-2-carbonitrile
Description:
6-Bromo-3-chlorobenzo[b]thiophene-2-carbonitrile is a heterocyclic organic compound characterized by the presence of a thiophene ring fused to a benzene ring, with bromine and chlorine substituents at specific positions. The compound features a carbonitrile functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of halogens (bromine and chlorine) can enhance the compound's biological activity and influence its electronic properties, making it of interest in the development of pharmaceuticals or agrochemicals. Additionally, the thiophene moiety can impart unique electronic characteristics, potentially making it useful in materials science, such as in organic semiconductors or dyes. The compound's structure suggests it may exhibit interesting interactions with biological targets, warranting further investigation into its pharmacological properties. Overall, 6-Bromo-3-chlorobenzo[b]thiophene-2-carbonitrile represents a versatile scaffold for further chemical exploration and application in various fields.
Formula:C9H3BrClNS
InChI:InChI=1S/C9H3BrClNS/c10-5-1-2-6-7(3-5)13-8(4-12)9(6)11/h1-3H
InChI key:InChIKey=FSMUFMSJQTVVDO-UHFFFAOYSA-N
SMILES:ClC=1C=2C(SC1C#N)=CC(Br)=CC2
Synonyms:- Benzo[b]thiophene-2-carbonitrile, 6-bromo-3-chloro-
- 6-Bromo-3-chlorobenzo[b]thiophene-2-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.